Target Relevance

Molecular Definition

Canonical SMILES CN(C)CCOC1=CC=C(C=C1)C(=C(\CCCl)C1=CC=CC=C1)\C1=CC=CC=C1
Formula C26H28ClNO
Molecular Weight 405.96 da
Stereocenters 0/0