Molecular Definition

Canonical SMILES COC1=CC=C2C(=CC=CC2=C1C(F)(F)F)C(=S)N(C)CC(O)=O
Formula C16H14F3NO3S
Molecular Weight 357.35 da
Stereocenters 0/0