Molecular Definition

Canonical SMILES ClC1=C(NC2=NCCN2)C2=NSN=C2C=C1
Formula C9H8ClN5S
Molecular Weight 253.71 da
Stereocenters 0/0