Target Relevance

Molecular Definition

Canonical SMILES Clc1ccc(cc1)[C@](c1cncn1C)(c1ccc2c(c1)c(cc(=O)n2C)c1cccc(c1)Cl)N
Formula C27H22Cl2N4O
Molecular Weight 489.40 da
Stereocenters 1/1