Molecular Definition

Canonical SMILES CCCC(C)C1(CC=C)C(=O)NC(=S)NC1=O
Formula C12H18N2O2S
Molecular Weight 254.35 da
Stereocenters 0/1