Molecular Definition

Canonical SMILES C#Cc1cccc(c1)NC1N=CN=C2C1C=C(NC(=O)N1C[C@H]3[C@@H](C1)CCN3C)C(=C2)OC
Formula C25H28N6O2
Molecular Weight 444.53 da
Stereocenters 2/4