Molecular Definition

Canonical SMILES OC[C@@]1(O)[C@H]2O[C@]3(O[C@@H]1[C@H]1[C@@]([C@H]2O)([C@@H]3O)NC(=N[C@@H]1O)N)O
Formula C11H17N3O8
Molecular Weight 319.27 da
Stereocenters 9/9