Molecular Definition

Canonical SMILES [H][C@@]12CC3=CNC4=C3C(=CC=C4)[C@@]1([H])C[C@@H](CN2C)NC(=O)N(CC)CC
Formula C20H28N4O
Molecular Weight 340.46 da
Stereocenters 3/3