Molecular Definition

Canonical SMILES CC(C)(C)NCC(O)C1=CC(O)=CC(O)=C1
Formula C12H19NO3
Molecular Weight 225.28 da
Stereocenters 0/1