Molecular Definition

Canonical SMILES CCC(C)C1(CC=C)C(=O)NC(=O)NC1=O
Formula C11H16N2O3
Molecular Weight 224.26 da
Stereocenters 0/1