Target Relevance

Molecular Definition

Canonical SMILES CCN(CC)CCNC(=O)c1c(C)[nH]c(\C=C\2/C(=O)Nc3ccc(F)cc23)c1C
Formula C22H27FN4O2
Molecular Weight 398.47 da
Stereocenters 0/0