Molecular Definition

Canonical SMILES O=C1C(CCS(=O)C2=CC=CC=C2)C(=O)N(N1C1=CC=CC=C1)C1=CC=CC=C1
Formula C23H20N2O3S
Molecular Weight 404.48 da
Stereocenters 0/0