Molecular Definition

Canonical SMILES Fc1ccc(cc1)C(=O)CCCN1CCC2(CC1)C(=O)NCN2c1ccccc1
Formula C23H26FN3O2
Molecular Weight 395.47 da
Stereocenters 0/0