Molecular Definition

Canonical SMILES CC(C)NCC(O)C1=CC=C(NS(C)(=O)=O)C=C1
Formula C12H20N2O3S
Molecular Weight 272.36 da
Stereocenters 0/1