Molecular Definition

Canonical SMILES C[C@H](Cc1cc2CCN(CCCO)c2c(c1)C(=O)N)NCCOc3ccccc3OCC(F)(F)F
Formula C25H32F3N3O4
Molecular Weight 495.53 da
Stereocenters 1/1