Molecular Definition

Canonical SMILES CCO[C@@H](CC1=CC=C(OCCN2C(C)=CC=C2C2=CC=C(SC)C=C2)C=C1)C(O)=O
Formula C25H29NO4S
Molecular Weight 439.57 da
Stereocenters 1/1