Molecular Definition

Canonical SMILES [H][C@]12CC(=O)N[C@]([H])(C(C)C)C(=O)N[C@]([H])(CSSCC\C=C\1)C(=O)N\C(=C/C)C(=O)N[C@@]([H])(C(C)C)C(=O)O2
Formula C24H36N4O6S2
Molecular Weight 540.70 da
Stereocenters 4/4