Molecular Definition

Canonical SMILES FC(F)OC1=C(OCC2CC2)C=C(C=C1)C(=O)NC1=C(Cl)C=NC=C1Cl
Formula C17H14Cl2F2N2O3
Molecular Weight 403.21 da
Stereocenters 0/0