Molecular Definition

Canonical SMILES [H][C@@]1(O)CC(=O)[C@]([H])(CCCCCCCO)[C@@]1([H])\C=C\CC(C)(O)CCCC
Formula C21H38O4
Molecular Weight 354.52 da
Stereocenters 3/4