Synonym

Target Relevance

Molecular Definition

Canonical SMILES C\C(=C/CO)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C
Formula C20H30O
Molecular Weight 286.45 da
Stereocenters 0/0