Target Relevance

Molecular Definition

Canonical SMILES [H][C@@](CC1CCCCC1)(NC(=O)[C@H](CC1=CNC=N1)NC(=O)[C@H](CC1=CC=CC=C1)CS(=O)(=O)C(C)(C)C)[C@@H](O)[C@@H](O)C1CC1
Formula C33H50N4O6S
Molecular Weight 630.84 da
Stereocenters 5/5