Molecular Definition

Canonical SMILES OC[C@H]1O[C@H]([C@@H]([C@@H]1O)O)n1cnc2c1nc(nc2N)n1ncc(c1)C(=O)NC
Formula C15H18N8O5
Molecular Weight 390.35 da
Stereocenters 4/4