ranitidine
A non-imidazole blocker of those histamine receptors that mediate gastric secretion (H2 receptors). It is used to treat gastrointestinal ulcers.
Target Relevance
| Histamine H2 receptor | Tclin |
| ANTAGONIST 310 | |
| pKd 2647 | 6.86 |
| pKd 2647 | 6.86 |
| pKd 2647 | 6.86 |
| pKd 2647 | 7.2 |
| Acetylcholinesterase | Tclin |
| pIC50 141091 | 6.19 |
Molecular Definition
| Canonical SMILES | CNC(NCCSCC1=CC=C(CN(C)C)O1)=C[N+]([O-])=O |
| Formula | C13H22N4O3S |
| Molecular Weight | 314.40 da |
| Stereocenters | 0/0 |