Molecular Definition

Canonical SMILES CNC(NCCSCC1=CC=C(CN(C)C)O1)=C[N+]([O-])=O
Formula C13H22N4O3S
Molecular Weight 314.40 da
Stereocenters 0/0