Molecular Definition

Canonical SMILES [H][C@@]1(C[C@@H]2CC[N@]1C[C@@H]2C=C)[C@@H](O)C1=CC=NC2=CC=C(OC)C=C12
Formula C20H24N2O2
Molecular Weight 324.42 da
Stereocenters 5/5