Molecular Definition

Canonical SMILES CCc1nc(N)nc(N)c1c2ccc(Cl)cc2
Formula C12H13ClN4
Molecular Weight 248.71 da
Stereocenters 0/0