Molecular Definition

Canonical SMILES CC(C)NCC(O)COc1cccc2ccccc12
Formula C16H21NO2
Molecular Weight 259.34 da
Stereocenters 0/1