Molecular Definition

Canonical SMILES CCCN(CCC)S(=O)(=O)C1=CC=C(C=C1)C(O)=O
Formula C13H19NO4S
Molecular Weight 285.36 da
Stereocenters 0/0