Molecular Definition

Canonical SMILES [H][C@@]12CC[C@](O)(C(=O)CO)[C@@]1(C)C[C@H](O)[C@@]1([H])[C@@]2([H])CCC2=CC(=O)C=C[C@]12C
Formula C21H28O5
Molecular Weight 360.44 da
Stereocenters 7/7