Target Relevance

Molecular Definition

Canonical SMILES [H]C(N1CCC2=C(C1)C=C(OC(C)=O)S2)(C(=O)C1CC1)C1=C(F)C=CC=C1
Formula C20H20FNO3S
Molecular Weight 373.44 da
Stereocenters 0/1