Target Relevance

Molecular Definition

Canonical SMILES CC[C@H]1[C@@H](CC2=CN=CN2C)COC1=O
Formula C11H16N2O2
Molecular Weight 208.26 da
Stereocenters 2/2