Molecular Definition

Canonical SMILES CC(COC1=CC=CC=C1)N(CCCl)CC1=CC=CC=C1
Formula C18H22ClNO
Molecular Weight 303.83 da
Stereocenters 0/1