Molecular Definition

Canonical SMILES O=C1N(C=C(C=C1C1=C(C=CC=C1)C#N)C1=CC=CC=N1)C1=CC=CC=C1
Formula C23H15N3O
Molecular Weight 349.38 da
Stereocenters 0/0