Molecular Definition

Canonical SMILES CN1C=NC2=C1C(=O)N(CCCCC(C)=O)C(=O)N2C
Formula C13H18N4O3
Molecular Weight 278.31 da
Stereocenters 0/0