Molecular Definition

Canonical SMILES C[N+]1(CCCCC[N+]2(C)CCCC2)CCCC1
Formula C15H32N2
Molecular Weight 240.43 da
Stereocenters 0/2