Molecular Definition

Canonical SMILES [H]C12CC3=CC=C(O)C=C3C(C)(CCN1CC=C(C)C)C2C
Formula C19H27NO
Molecular Weight 285.42 da
Stereocenters 0/3