Molecular Definition

Canonical SMILES CC[C@@H](OC1=CC=CC(CN(CCCOC2=CC=C(OC)C=C2)C2=NC3=C(O2)C=CC=C3)=C1)C(O)=O
Formula C28H30N2O6
Molecular Weight 490.55 da
Stereocenters 1/1