Molecular Definition

Canonical SMILES COC1=CC=NC(CS(=O)C2=NC3=C(N2)C=C(OC(F)F)C=C3)=C1OC
Formula C16H15F2N3O4S
Molecular Weight 383.37 da
Stereocenters 0/0