Molecular Definition

Canonical SMILES CCCCOC1=C(N)C=CC(=C1)C(=O)OCCN(CC)CC
Formula C17H28N2O3
Molecular Weight 308.42 da
Stereocenters 0/0