Target Relevance

Molecular Definition

Canonical SMILES [H][C@@]12CC[C@](C)(O)[C@@]1(C)CC[C@@]1([H])[C@@]2([H])CC[C@@]2([H])CC(=O)OC[C@]12C
Formula C19H30O3
Molecular Weight 306.44 da
Stereocenters 7/7