Target Relevance

Molecular Definition

Canonical SMILES COC1=CC=C(CC(C)(C)NC[C@H](O)C2=C3OCC(=O)NC3=CC(O)=C2)C=C1
Formula C21H26N2O5
Molecular Weight 386.44 da
Stereocenters 1/1