Molecular Definition

Canonical SMILES CCCCCCCC\C=C/CCCCCCCC(O)=O
Formula C18H34O2
Molecular Weight 282.46 da
Stereocenters 0/0