Molecular Definition

Canonical SMILES CN1CCN(CC1)C1=c2cc(sc2=Nc2c(N1)cccc2)C
Formula C17H20N4S
Molecular Weight 312.43 da
Stereocenters 0/0