Molecular Definition

Canonical SMILES Oc1ccc(c2cccnc12)[N+](=O)[O-]
Formula C9H6N2O3
Molecular Weight 190.16 da
Stereocenters 0/0