Molecular Definition

Canonical SMILES [H][C@]1(CCCNC1)C1=CC=C(C=C1)N1C=C2C=CC=C(C(N)=O)C2=N1
Formula C19H20N4O
Molecular Weight 320.39 da
Stereocenters 1/1