Molecular Definition

Canonical SMILES Oc1ccc(Cl)cc1C(=O)Nc2ccc(cc2Cl)[N+](=O)[O-]
Formula C13H8Cl2N2O4
Molecular Weight 327.12 da
Stereocenters 0/0