Molecular Definition

Canonical SMILES CNS(=O)(=O)CCC1=CC=C2NC=C(C3CCN(C)CC3)C2=C1
Formula C17H25N3O2S
Molecular Weight 335.46 da
Stereocenters 0/0