Molecular Definition

Canonical SMILES C(C1=NCCN1)C1=CC=CC2=CC=CC=C12
Formula C14H14N2
Molecular Weight 210.27 da
Stereocenters 0/0