Molecular Definition

Canonical SMILES [H][C@@]12CC[C@H](O)[C@@]1(C)CC[C@]1([H])[C@@]3([H])CCC(=O)C=C3CC[C@@]21[H]
Formula C18H26O2
Molecular Weight 274.40 da
Stereocenters 6/6