Molecular Definition

Canonical SMILES [H][C@@]12OC3=C4C(C[C@@]5([H])N(CC=C)CC[C@@]14[C@@]5(O)CCC2=O)=CC=C3O
Formula C19H21NO4
Molecular Weight 327.37 da
Stereocenters 4/4