Molecular Definition

Canonical SMILES COC1=C(C=CC=C1)N1CCN(CC(O)COC2=CC=CC3=CC=CC=C23)CC1
Formula C24H28N2O3
Molecular Weight 392.49 da
Stereocenters 0/1